C39H36N2O4 — CID 23891424
(4R,5R)-N,4-dibenzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23891424) has the molecular formula C39H36N2O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is (4R,5R)-N,4-dibenzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-N,4-dibenzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23891424 |
| Molecular Formula | C39H36N2O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | (4R,5R)-N,4-dibenzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H36N2O4/c42-25-10-26-44-35-23-21-34(22-24-35)37-41-39(27-29-11-4-1-5-12-29,38(43)40-28-30-13-6-2-7-14-30)36(45-37)33-19-17-32(18-20-33)31-15-8-3-9-16-31/h1-9,11-24,36,42H,10,25-28H2,(H,40,43)/t36-,39-/m1/s1 |
| InChIKey | QUTBKWGREZQKED-AEGYFVCZSA-N |
| XLogP | 6.93 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|