C32H31N3O4 — CID 23806957
(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N',5-diphenyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806957) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N',5-diphenyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N',5-diphenyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806957 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N',5-diphenyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H31N3O4/c36-21-10-22-38-28-19-17-26(18-20-28)30-33-32(23-24-11-4-1-5-12-24,29(39-30)25-13-6-2-7-14-25)31(37)35-34-27-15-8-3-9-16-27/h1-9,11-20,29,34,36H,10,21-23H2,(H,35,37)/t29-,32-/m0/s1 |
| InChIKey | LUZJITNJXUWXPO-NYDCQLBNSA-N |
| XLogP | 5.09 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|