C36H39N3O4 — CID 23975661
(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-N'-(4-phenylbutyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975661) has the molecular formula C36H39N3O4 and a molecular weight of 577.73 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-N'-(4-phenylbutyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-N'-(4-phenylbutyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975661 |
| Molecular Formula | C36H39N3O4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-N'-(4-phenylbutyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCCCCc1ccccc1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C36H39N3O4/c40-25-12-26-42-32-22-20-31(21-23-32)34-38-36(27-29-16-6-2-7-17-29,33(43-34)30-18-8-3-9-19-30)35(41)39-37-24-11-10-15-28-13-4-1-5-14-28/h1-9,13-14,16-23,33,37,40H,10-12,15,24-27H2,(H,39,41)/t33-,36-/m0/s1 |
| InChIKey | LQHWBHHCGGBHSL-JUKUECOXSA-N |
| XLogP | 5.59 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|