C34H33ClN2O4 — CID 23920017
(4R,5R)-4-benzyl-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23920017) has the molecular formula C34H33ClN2O4 and a molecular weight of 569.10 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23920017 |
| Molecular Formula | C34H33ClN2O4 |
| Molecular Weight | 569.10 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (4R,5R)-4-benzyl-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H33ClN2O4/c35-29-16-12-25(13-17-29)20-21-36-33(39)34(24-26-8-3-1-4-9-26)31(27-10-5-2-6-11-27)41-32(37-34)28-14-18-30(19-15-28)40-23-7-22-38/h1-6,8-19,31,38H,7,20-24H2,(H,36,39)/t31-,34-/m1/s1 |
| InChIKey | BLAZEUPXPXERFI-QIKUIUABSA-N |
| XLogP | 5.96 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.10 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|