C33H29Cl3N2O4 — CID 23778310
(4R,5R)-4-benzyl-N-[(4-chlorophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778310) has the molecular formula C33H29Cl3N2O4 and a molecular weight of 623.96 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-N-[(4-chlorophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-N-[(4-chlorophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778310 |
| Molecular Formula | C33H29Cl3N2O4 |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | (4R,5R)-4-benzyl-N-[(4-chlorophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H29Cl3N2O4/c34-25-11-7-23(8-12-25)21-37-32(40)33(20-22-5-2-1-3-6-22)30(28-16-13-26(35)19-29(28)36)42-31(38-33)24-9-14-27(15-10-24)41-18-4-17-39/h1-3,5-16,19,30,39H,4,17-18,20-21H2,(H,37,40)/t30-,33-/m1/s1 |
| InChIKey | SNSZJWOBQCKBLG-LXANVCGNSA-N |
| XLogP | 7.22 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|