C30H31BrCl2N2O6 — CID 23864261
(4R,5R)-4-[(4-bromophenyl)methyl]-5-(2,4-dichlorophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864261) has the molecular formula C30H31BrCl2N2O6 and a molecular weight of 666.40 g/mol. Its IUPAC name is (4R,5R)-4-[(4-bromophenyl)methyl]-5-(2,4-dichlorophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(4-bromophenyl)methyl]-5-(2,4-dichlorophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864261 |
| Molecular Formula | C30H31BrCl2N2O6 |
| Molecular Weight | 666.40 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | (4R,5R)-4-[(4-bromophenyl)methyl]-5-(2,4-dichlorophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COC(CNC(=O)[C@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Cl)cc1Cl)OC |
| InChI | InChI=1S/C30H31BrCl2N2O6/c1-38-26(39-2)18-34-29(37)30(17-19-4-8-21(31)9-5-19)27(24-13-10-22(32)16-25(24)33)41-28(35-30)20-6-11-23(12-7-20)40-15-3-14-36/h4-13,16,26-27,36H,3,14-15,17-18H2,1-2H3,(H,34,37)/t27-,30-/m1/s1 |
| InChIKey | CIIMWLCSQKZNNC-POURPWNDSA-N |
| XLogP | 5.75 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|