C30H32BrCl2N3O4 — CID 23806359
(4S,5S)-4-[(4-bromophenyl)methyl]-N'-butyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806359) has the molecular formula C30H32BrCl2N3O4 and a molecular weight of 649.41 g/mol. Its IUPAC name is (4S,5S)-4-[(4-bromophenyl)methyl]-N'-butyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N'-butyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806359 |
| Molecular Formula | C30H32BrCl2N3O4 |
| Molecular Weight | 649.41 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N'-butyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CCCCNNC(=O)[C@@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H32BrCl2N3O4/c1-2-3-15-34-36-29(38)30(19-20-5-9-22(31)10-6-20)27(25-14-11-23(32)18-26(25)33)40-28(35-30)21-7-12-24(13-8-21)39-17-4-16-37/h5-14,18,27,34,37H,2-4,15-17,19H2,1H3,(H,36,38)/t27-,30-/m0/s1 |
| InChIKey | MKDYIZUUPQLPKV-FIBWVYCGSA-N |
| XLogP | 6.44 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.41 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|