C35H34Cl2N2O4 — CID 23976128
(4R,5R)-4-benzyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23976128) has the molecular formula C35H34Cl2N2O4 and a molecular weight of 617.57 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23976128 |
| Molecular Formula | C35H34Cl2N2O4 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | (4R,5R)-4-benzyl-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H34Cl2N2O4/c36-28-16-19-30(31(37)23-28)32-35(24-26-11-5-2-6-12-26,34(41)38-20-7-13-25-9-3-1-4-10-25)39-33(43-32)27-14-17-29(18-15-27)42-22-8-21-40/h1-6,9-12,14-19,23,32,40H,7-8,13,20-22,24H2,(H,38,41)/t32-,35-/m1/s1 |
| InChIKey | IHJKYRSALUMTLJ-FHPVIJFVSA-N |
| XLogP | 7.00 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|