C33H30BrClN2O4 — CID 23976137
(4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[(3-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23976137) has the molecular formula C33H30BrClN2O4 and a molecular weight of 633.97 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[(3-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[(3-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23976137 |
| Molecular Formula | C33H30BrClN2O4 |
| Molecular Weight | 633.97 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[(3-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C33H30BrClN2O4/c34-29-13-5-4-12-28(29)30-33(21-23-8-2-1-3-9-23,32(39)36-22-24-10-6-11-26(35)20-24)37-31(41-30)25-14-16-27(17-15-25)40-19-7-18-38/h1-6,8-17,20,30,38H,7,18-19,21-22H2,(H,36,39)/t30-,33-/m1/s1 |
| InChIKey | NBDNITLCEAPQDV-LXANVCGNSA-N |
| XLogP | 6.68 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.97 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|