C34H32BrFN2O4 — CID 23920184
(4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23920184) has the molecular formula C34H32BrFN2O4 and a molecular weight of 631.54 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23920184 |
| Molecular Formula | C34H32BrFN2O4 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | (4R,5R)-4-benzyl-5-(2-bromophenyl)-N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C34H32BrFN2O4/c35-30-10-5-4-9-29(30)31-34(23-25-7-2-1-3-8-25,33(40)37-20-19-24-11-15-27(36)16-12-24)38-32(42-31)26-13-17-28(18-14-26)41-22-6-21-39/h1-5,7-18,31,39H,6,19-23H2,(H,37,40)/t31-,34-/m1/s1 |
| InChIKey | GTKAKSWICIUIJG-QIKUIUABSA-N |
| XLogP | 6.21 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|