C36H36BrN5O4 — CID 23947994
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947994) has the molecular formula C36H36BrN5O4 and a molecular weight of 682.62 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947994 |
| Molecular Formula | C36H36BrN5O4 |
| Molecular Weight | 682.62 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-phenylpropyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@@]1(C(=O)NCCCc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C36H36BrN5O4/c37-32-16-7-6-15-31(32)33-36(24-28-13-4-5-14-29(28)25-40-42-38,35(44)39-21-8-12-26-10-2-1-3-11-26)41-34(46-33)27-17-19-30(20-18-27)45-23-9-22-43/h1-7,10-11,13-20,33,43H,8-9,12,21-25H2,(H,39,44)/t33-,36-/m1/s1 |
| InChIKey | GFAQBEMVOIDJNO-YYFXGUOYSA-N |
| XLogP | 7.27 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|