C36H36BrN5O6 — CID 23778260
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778260) has the molecular formula C36H36BrN5O6 and a molecular weight of 714.62 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778260 |
| Molecular Formula | C36H36BrN5O6 |
| Molecular Weight | 714.62 g/mol |
| Exact Mass | 713.18 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@]2(Cc3ccccc3CN=[N+]=[N-])N=C(c3ccc(OCCCO)cc3)O[C@@H]2c2ccccc2Br)c1OC |
| InChI | InChI=1S/C36H36BrN5O6/c1-45-31-14-7-11-27(32(31)46-2)22-39-35(44)36(21-25-9-3-4-10-26(25)23-40-42-38)33(29-12-5-6-13-30(29)37)48-34(41-36)24-15-17-28(18-16-24)47-20-8-19-43/h3-7,9-18,33,43H,8,19-23H2,1-2H3,(H,39,44)/t33-,36-/m1/s1 |
| InChIKey | ZQIRGZDHDZOPJT-YYFXGUOYSA-N |
| XLogP | 6.85 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|