C33H37BrN6O5 — CID 23947160
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947160) has the molecular formula C33H37BrN6O5 and a molecular weight of 677.60 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947160 |
| Molecular Formula | C33H37BrN6O5 |
| Molecular Weight | 677.60 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-bromophenyl)-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NNC2CCC(O)CC2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C33H37BrN6O5/c34-29-9-4-3-8-28(29)30-33(20-23-6-1-2-7-24(23)21-36-40-35,32(43)39-38-25-12-14-26(42)15-13-25)37-31(45-30)22-10-16-27(17-11-22)44-19-5-18-41/h1-4,6-11,16-17,25-26,30,38,41-42H,5,12-15,18-21H2,(H,39,43)/t25?,26?,30-,33-/m0/s1 |
| InChIKey | BMSZAOSXWNSFLK-ZEPCRGDTSA-N |
| XLogP | 5.44 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|