C33H38N6O5 — CID 23748125
(4S,5S)-5-[2-(azidomethyl)phenyl]-4-benzyl-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748125) has the molecular formula C33H38N6O5 and a molecular weight of 598.70 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-4-benzyl-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-benzyl-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748125 |
| Molecular Formula | C33H38N6O5 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-benzyl-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1)C(=O)NNC1CCC(O)CC1 |
| InChI | InChI=1S/C33H38N6O5/c34-39-35-22-25-9-4-5-10-29(25)30-33(21-23-7-2-1-3-8-23,32(42)38-37-26-13-15-27(41)16-14-26)36-31(44-30)24-11-17-28(18-12-24)43-20-6-19-40/h1-5,7-12,17-18,26-27,30,37,40-41H,6,13-16,19-22H2,(H,38,42)/t26?,27?,30-,33-/m0/s1 |
| InChIKey | VYPZSOWGYSQCMV-IBDOERJYSA-N |
| XLogP | 4.68 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|