C32H35Br2N3O5 — CID 23863979
(4S,5S)-5-(2-bromophenyl)-4-[(4-bromophenyl)methyl]-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863979) has the molecular formula C32H35Br2N3O5 and a molecular weight of 701.46 g/mol. Its IUPAC name is (4S,5S)-5-(2-bromophenyl)-4-[(4-bromophenyl)methyl]-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-bromophenyl)-4-[(4-bromophenyl)methyl]-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863979 |
| Molecular Formula | C32H35Br2N3O5 |
| Molecular Weight | 701.46 g/mol |
| Exact Mass | 699.09 |
| IUPAC Name | (4S,5S)-5-(2-bromophenyl)-4-[(4-bromophenyl)methyl]-N'-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNC1CCC(O)CC1)[C@@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C32H35Br2N3O5/c33-23-10-6-21(7-11-23)20-32(31(40)37-36-24-12-14-25(39)15-13-24)29(27-4-1-2-5-28(27)34)42-30(35-32)22-8-16-26(17-9-22)41-19-3-18-38/h1-2,4-11,16-17,24-25,29,36,38-39H,3,12-15,18-20H2,(H,37,40)/t24?,25?,29-,32-/m0/s1 |
| InChIKey | GBMSGBNCBDCGBO-HYUNUCTBSA-N |
| XLogP | 5.40 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|