C27H27BrN6O4 — CID 23835030
(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23835030) has the molecular formula C27H27BrN6O4 and a molecular weight of 579.46 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23835030 |
| Molecular Formula | C27H27BrN6O4 |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccc(Br)cc1)C(=O)NN |
| InChI | InChI=1S/C27H27BrN6O4/c28-21-10-6-18(7-11-21)16-27(26(36)33-29)24(23-5-2-1-4-20(23)17-31-34-30)38-25(32-27)19-8-12-22(13-9-19)37-15-3-14-35/h1-2,4-13,24,35H,3,14-17,29H2,(H,33,36)/t24-,27-/m0/s1 |
| InChIKey | UUKKVSYVOOKCEE-IGKIAQTJSA-N |
| XLogP | 4.51 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|