C35H33F2N5O4 — CID 23891390
(4R,5R)-5-[2-(azidomethyl)phenyl]-4-benzyl-N-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23891390) has the molecular formula C35H33F2N5O4 and a molecular weight of 625.68 g/mol. Its IUPAC name is (4R,5R)-5-[2-(azidomethyl)phenyl]-4-benzyl-N-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-benzyl-N-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23891390 |
| Molecular Formula | C35H33F2N5O4 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-benzyl-N-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(Cc1ccccc1)C(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C35H33F2N5O4/c36-28-19-25(20-29(37)21-28)15-16-39-34(44)35(22-24-7-2-1-3-8-24)32(31-10-5-4-9-27(31)23-40-42-38)46-33(41-35)26-11-13-30(14-12-26)45-18-6-17-43/h1-5,7-14,19-21,32,43H,6,15-18,22-23H2,(H,39,44)/t32-,35-/m1/s1 |
| InChIKey | MQTLPCSJVRPKFV-FHPVIJFVSA-N |
| XLogP | 6.39 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|