C34H32N8O4 — CID 23777079
(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23777079) has the molecular formula C34H32N8O4 and a molecular weight of 616.68 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23777079 |
| Molecular Formula | C34H32N8O4 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1N=[N+]=[N-])C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H32N8O4/c35-41-38-23-27-12-4-6-13-29(27)31-34(21-26-11-5-7-14-30(26)40-42-36,33(44)37-22-24-9-2-1-3-10-24)39-32(46-31)25-15-17-28(18-16-25)45-20-8-19-43/h1-7,9-18,31,43H,8,19-23H2,(H,37,44)/t31-,34-/m0/s1 |
| InChIKey | YNDYWVPBEIYAKR-VBTAUBHQSA-N |
| XLogP | 7.02 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|