C34H31F2N9O4 — CID 23919755
(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919755) has the molecular formula C34H31F2N9O4 and a molecular weight of 667.68 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919755 |
| Molecular Formula | C34H31F2N9O4 |
| Molecular Weight | 667.68 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1N=[N+]=[N-])C(=O)NNCc1ccc(F)cc1F |
| InChI | InChI=1S/C34H31F2N9O4/c35-26-13-10-25(29(36)18-26)21-39-43-33(47)34(19-23-6-2-4-9-30(23)42-45-38)31(28-8-3-1-7-24(28)20-40-44-37)49-32(41-34)22-11-14-27(15-12-22)48-17-5-16-46/h1-4,6-15,18,31,39,46H,5,16-17,19-21H2,(H,43,47)/t31-,34-/m0/s1 |
| InChIKey | ZVHXNXDGZVBIFD-VBTAUBHQSA-N |
| XLogP | 6.80 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|