C35H33N9O6 — CID 23806988
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806988) has the molecular formula C35H33N9O6 and a molecular weight of 675.71 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806988 |
| Molecular Formula | C35H33N9O6 |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NNCc2ccc3c(c2)OCO3)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C35H33N9O6/c36-43-39-21-26-7-2-1-6-25(26)19-35(34(46)42-38-20-23-10-15-30-31(18-23)49-22-48-30)32(28-8-3-4-9-29(28)41-44-37)50-33(40-35)24-11-13-27(14-12-24)47-17-5-16-45/h1-4,6-15,18,32,38,45H,5,16-17,19-22H2,(H,42,46)/t32-,35-/m0/s1 |
| InChIKey | WOMOPQFNFXMBQG-SHUZPENHSA-N |
| XLogP | 6.25 |
| TPSA | 208.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|