C36H36N6O7 — CID 23778050
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23778050) has the molecular formula C36H36N6O7 and a molecular weight of 664.72 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23778050 |
| Molecular Formula | C36H36N6O7 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-(1,3-benzodioxol-5-ylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2CN=[N+]=[N-])C(=O)NNCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C36H36N6O7/c1-45-30-9-4-8-26(19-30)33-36(20-27-6-2-3-7-28(27)22-39-42-37,35(44)41-38-21-24-10-15-31-32(18-24)48-23-47-31)40-34(49-33)25-11-13-29(14-12-25)46-17-5-16-43/h2-4,6-15,18-19,33,38,43H,5,16-17,20-23H2,1H3,(H,41,44)/t33-,36-/m0/s1 |
| InChIKey | VZZZWIQLQUZTKG-JUKUECOXSA-N |
| XLogP | 5.32 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|