C34H41N5O6 — CID 23778396
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778396) has the molecular formula C34H41N5O6 and a molecular weight of 615.73 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778396 |
| Molecular Formula | C34H41N5O6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2CN=[N+]=[N-])C(=O)NCCCOC(C)C)c1 |
| InChI | InChI=1S/C34H41N5O6/c1-24(2)43-19-7-17-36-33(41)34(22-27-9-4-5-10-28(27)23-37-39-35)31(26-11-6-12-30(21-26)42-3)45-32(38-34)25-13-15-29(16-14-25)44-20-8-18-40/h4-6,9-16,21,24,31,40H,7-8,17-20,22-23H2,1-3H3,(H,36,41)/t31-,34-/m1/s1 |
| InChIKey | UAPXGYYPXLAIES-QIKUIUABSA-N |
| XLogP | 5.70 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|