C30H34N6O5 — CID 23975280
(4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975280) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975280 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2N=[N+]=[N-])C(=O)NNC(C)C)c1 |
| InChI | InChI=1S/C30H34N6O5/c1-20(2)33-35-29(38)30(19-23-8-4-5-11-26(23)34-36-31)27(22-9-6-10-25(18-22)39-3)41-28(32-30)21-12-14-24(15-13-21)40-17-7-16-37/h4-6,8-15,18,20,27,33,37H,7,16-17,19H2,1-3H3,(H,35,38)/t27-,30-/m0/s1 |
| InChIKey | IKPMGVQYRLETGQ-FIBWVYCGSA-N |
| XLogP | 4.93 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|