C34H31Cl2N5O5 — CID 23806615
(4R,5R)-4-[(2-azidophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23806615) has the molecular formula C34H31Cl2N5O5 and a molecular weight of 660.56 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23806615 |
| Molecular Formula | C34H31Cl2N5O5 |
| Molecular Weight | 660.56 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2N=[N+]=[N-])C(=O)NCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C34H31Cl2N5O5/c1-44-27-8-4-7-24(19-27)31-34(20-25-6-2-3-9-30(25)40-41-37,33(43)38-21-22-10-15-28(35)29(36)18-22)39-32(46-31)23-11-13-26(14-12-23)45-17-5-16-42/h2-4,6-15,18-19,31,42H,5,16-17,20-21H2,1H3,(H,38,43)/t31-,34-/m1/s1 |
| InChIKey | KFMIGIDSQSLXNB-QIKUIUABSA-N |
| XLogP | 7.52 |
| TPSA | 138.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.56 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|