C36H34F3N5O5 — CID 23892184
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23892184) has the molecular formula C36H34F3N5O5 and a molecular weight of 673.69 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23892184 |
| Molecular Formula | C36H34F3N5O5 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2CN=[N+]=[N-])C(=O)NCc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C36H34F3N5O5/c1-47-30-12-6-11-25(20-30)32-35(21-26-8-2-3-9-27(26)23-42-44-40,34(46)41-22-28-10-4-5-13-31(28)36(37,38)39)43-33(49-32)24-14-16-29(17-15-24)48-19-7-18-45/h2-6,8-17,20,32,45H,7,18-19,21-23H2,1H3,(H,41,46)/t32-,35-/m1/s1 |
| InChIKey | FHFJBCBEMWHFDR-FHPVIJFVSA-N |
| XLogP | 7.10 |
| TPSA | 138.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|