C36H37ClN6O5 — CID 23749010
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23749010) has the molecular formula C36H37ClN6O5 and a molecular weight of 669.18 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23749010 |
| Molecular Formula | C36H37ClN6O5 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2CN=[N+]=[N-])C(=O)NNCCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C36H37ClN6O5/c1-46-31-12-6-11-27(22-31)33-36(23-28-9-2-3-10-29(28)24-40-43-38,35(45)42-39-19-18-25-8-4-5-13-32(25)37)41-34(48-33)26-14-16-30(17-15-26)47-21-7-20-44/h2-6,8-17,22,33,39,44H,7,18-21,23-24H2,1H3,(H,42,45)/t33-,36-/m0/s1 |
| InChIKey | CPPSCAXKEJJTCW-JUKUECOXSA-N |
| XLogP | 6.28 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|