C34H32Cl2N6O5 — CID 23807095
(4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23807095) has the molecular formula C34H32Cl2N6O5 and a molecular weight of 675.57 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23807095 |
| Molecular Formula | C34H32Cl2N6O5 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2N=[N+]=[N-])C(=O)NNCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C34H32Cl2N6O5/c1-45-27-8-4-7-24(19-27)31-34(20-25-6-2-3-9-30(25)40-42-37,33(44)41-38-21-22-10-15-28(35)29(36)18-22)39-32(47-31)23-11-13-26(14-12-23)46-17-5-16-43/h2-4,6-15,18-19,31,38,43H,5,16-17,20-21H2,1H3,(H,41,44)/t31-,34-/m0/s1 |
| InChIKey | KQEUTCAXIIVWEE-VBTAUBHQSA-N |
| XLogP | 7.03 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|