C33H28Cl2F2N6O4 — CID 23919301
(4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919301) has the molecular formula C33H28Cl2F2N6O4 and a molecular weight of 681.53 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919301 |
| Molecular Formula | C33H28Cl2F2N6O4 |
| Molecular Weight | 681.53 g/mol |
| Exact Mass | 680.15 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@]1(C(=O)NNCc2ccc(F)c(F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H28Cl2F2N6O4/c34-23-9-12-25(26(35)17-23)30-33(18-22-4-1-2-5-29(22)41-43-38,32(45)42-39-19-20-6-13-27(36)28(37)16-20)40-31(47-30)21-7-10-24(11-8-21)46-15-3-14-44/h1-2,4-13,16-17,30,39,44H,3,14-15,18-19H2,(H,42,45)/t30-,33-/m0/s1 |
| InChIKey | RFKWBMUTBJOANT-DITALETJSA-N |
| XLogP | 7.30 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|