C33H30FN9O4 — CID 23947136
(4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947136) has the molecular formula C33H30FN9O4 and a molecular weight of 635.66 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947136 |
| Molecular Formula | C33H30FN9O4 |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@]1(C(=O)NNCc2ccccc2F)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C33H30FN9O4/c34-27-11-4-1-9-24(27)21-37-41-32(45)33(20-23-8-2-5-12-28(23)39-42-35)30(26-10-3-6-13-29(26)40-43-36)47-31(38-33)22-14-16-25(17-15-22)46-19-7-18-44/h1-6,8-17,30,37,44H,7,18-21H2,(H,41,45)/t30-,33-/m0/s1 |
| InChIKey | LTLOSYRYBFZCRV-DITALETJSA-N |
| XLogP | 6.79 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|