C33H31ClN6O4 — CID 23919192
(4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(2-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919192) has the molecular formula C33H31ClN6O4 and a molecular weight of 611.10 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(2-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(2-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919192 |
| Molecular Formula | C33H31ClN6O4 |
| Molecular Weight | 611.10 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-N'-[(2-chlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@]1(C(=O)NNCc2ccccc2Cl)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H31ClN6O4/c34-28-13-6-4-12-26(28)22-36-39-32(42)33(21-25-11-5-7-14-29(25)38-40-35)30(23-9-2-1-3-10-23)44-31(37-33)24-15-17-27(18-16-24)43-20-8-19-41/h1-7,9-18,30,36,41H,8,19-22H2,(H,39,42)/t30-,33-/m0/s1 |
| InChIKey | VMVVPOXTXWISRX-DITALETJSA-N |
| XLogP | 6.36 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.10 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|