C35H36N6O4 — CID 23891921
(4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891921) has the molecular formula C35H36N6O4 and a molecular weight of 604.71 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891921 |
| Molecular Formula | C35H36N6O4 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CC(C)NNC(=O)[C@@]1(Cc2ccccc2N=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H36N6O4/c1-24(2)38-40-34(43)35(23-29-11-6-7-12-31(29)39-41-36)32(27-15-13-26(14-16-27)25-9-4-3-5-10-25)45-33(37-35)28-17-19-30(20-18-28)44-22-8-21-42/h3-7,9-20,24,32,38,42H,8,21-23H2,1-2H3,(H,40,43)/t32-,35-/m0/s1 |
| InChIKey | TXCRLRRMJBUCPV-SHUZPENHSA-N |
| XLogP | 6.59 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|