C29H31BrN6O4 — CID 23947198
(4S,5S)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947198) has the molecular formula C29H31BrN6O4 and a molecular weight of 607.51 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947198 |
| Molecular Formula | C29H31BrN6O4 |
| Molecular Weight | 607.51 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-propan-2-yl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CC(C)NNC(=O)[C@@]1(Cc2ccccc2N=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H31BrN6O4/c1-19(2)33-35-28(38)29(18-22-6-3-4-7-25(22)34-36-31)26(20-8-12-23(30)13-9-20)40-27(32-29)21-10-14-24(15-11-21)39-17-5-16-37/h3-4,6-15,19,26,33,37H,5,16-18H2,1-2H3,(H,35,38)/t26-,29-/m0/s1 |
| InChIKey | VIHUHIZXMSKSOY-WNJJXGMVSA-N |
| XLogP | 5.68 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|