C30H32BrN5O6 — CID 23806581
(4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23806581) has the molecular formula C30H32BrN5O6 and a molecular weight of 638.52 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23806581 |
| Molecular Formula | C30H32BrN5O6 |
| Molecular Weight | 638.52 g/mol |
| Exact Mass | 637.15 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COC(CNC(=O)[C@]1(Cc2ccccc2N=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1)OC |
| InChI | InChI=1S/C30H32BrN5O6/c1-39-26(40-2)19-33-29(38)30(18-22-6-3-4-7-25(22)35-36-32)27(20-8-12-23(31)13-9-20)42-28(34-30)21-10-14-24(15-11-21)41-17-5-16-37/h3-4,6-15,26-27,37H,5,16-19H2,1-2H3,(H,33,38)/t27-,30-/m1/s1 |
| InChIKey | YCFUYOJPBWAWND-POURPWNDSA-N |
| XLogP | 5.39 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|