C30H33Br2N3O6 — CID 23947765
(4S,5S)-5-(4-bromophenyl)-4-[(2-bromophenyl)methyl]-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947765) has the molecular formula C30H33Br2N3O6 and a molecular weight of 691.42 g/mol. Its IUPAC name is (4S,5S)-5-(4-bromophenyl)-4-[(2-bromophenyl)methyl]-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(4-bromophenyl)-4-[(2-bromophenyl)methyl]-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947765 |
| Molecular Formula | C30H33Br2N3O6 |
| Molecular Weight | 691.42 g/mol |
| Exact Mass | 689.07 |
| IUPAC Name | (4S,5S)-5-(4-bromophenyl)-4-[(2-bromophenyl)methyl]-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COC(CNNC(=O)[C@@]1(Cc2ccccc2Br)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1)OC |
| InChI | InChI=1S/C30H33Br2N3O6/c1-38-26(39-2)19-33-35-29(37)30(18-22-6-3-4-7-25(22)32)27(20-8-12-23(31)13-9-20)41-28(34-30)21-10-14-24(15-11-21)40-17-5-16-36/h3-4,6-15,26-27,33,36H,5,16-19H2,1-2H3,(H,35,37)/t27-,30-/m0/s1 |
| InChIKey | NSPWAIVJMXJVDV-FIBWVYCGSA-N |
| XLogP | 4.71 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|