C31H34BrN5O6 — CID 23778332
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778332) has the molecular formula C31H34BrN5O6 and a molecular weight of 652.55 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778332 |
| Molecular Formula | C31H34BrN5O6 |
| Molecular Weight | 652.55 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COC(CNC(=O)[C@]1(Cc2ccccc2CN=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1)OC |
| InChI | InChI=1S/C31H34BrN5O6/c1-40-27(41-2)20-34-30(39)31(18-23-6-3-4-7-24(23)19-35-37-33)28(21-8-12-25(32)13-9-21)43-29(36-31)22-10-14-26(15-11-22)42-17-5-16-38/h3-4,6-15,27-28,38H,5,16-20H2,1-2H3,(H,34,39)/t28-,31-/m1/s1 |
| InChIKey | DILLYEVIMURENS-GRKNLSHJSA-N |
| XLogP | 5.26 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|