C35H33BrF2N6O4 — CID 23806977
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N'-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806977) has the molecular formula C35H33BrF2N6O4 and a molecular weight of 719.59 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N'-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N'-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806977 |
| Molecular Formula | C35H33BrF2N6O4 |
| Molecular Weight | 719.59 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(4-bromophenyl)-N'-[2-(3,5-difluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NNCCc2cc(F)cc(F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C35H33BrF2N6O4/c36-28-10-6-24(7-11-28)32-35(21-26-4-1-2-5-27(26)22-41-44-39,34(46)43-40-15-14-23-18-29(37)20-30(38)19-23)42-33(48-32)25-8-12-31(13-9-25)47-17-3-16-45/h1-2,4-13,18-20,32,40,45H,3,14-17,21-22H2,(H,43,46)/t32-,35-/m0/s1 |
| InChIKey | AIUGWZYNIOAJCW-SHUZPENHSA-N |
| XLogP | 6.66 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|