C40H37FN6O4 — CID 23919310
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919310) has the molecular formula C40H37FN6O4 and a molecular weight of 684.77 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919310 |
| Molecular Formula | C40H37FN6O4 |
| Molecular Weight | 684.77 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NNCc2ccccc2F)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H37FN6O4/c41-36-14-7-6-13-34(36)27-43-46-39(49)40(25-32-11-4-5-12-33(32)26-44-47-42)37(30-17-15-29(16-18-30)28-9-2-1-3-10-28)51-38(45-40)31-19-21-35(22-20-31)50-24-8-23-48/h1-7,9-22,37,43,48H,8,23-27H2,(H,46,49)/t37-,40-/m0/s1 |
| InChIKey | GTVCCCMGNPVFEY-DFUITMLUSA-N |
| XLogP | 7.38 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|