C40H37BrN2O4 — CID 23891362
(4R,5R)-4-[(2-bromophenyl)methyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23891362) has the molecular formula C40H37BrN2O4 and a molecular weight of 689.65 g/mol. Its IUPAC name is (4R,5R)-4-[(2-bromophenyl)methyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-bromophenyl)methyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23891362 |
| Molecular Formula | C40H37BrN2O4 |
| Molecular Weight | 689.65 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | (4R,5R)-4-[(2-bromophenyl)methyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)[C@]1(Cc2ccccc2Br)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C40H37BrN2O4/c41-36-20-11-10-19-33(36)27-40(39(45)42-28-35(29-13-4-1-5-14-29)30-15-6-2-7-16-30)37(31-17-8-3-9-18-31)47-38(43-40)32-21-23-34(24-22-32)46-26-12-25-44/h1-11,13-24,35,37,44H,12,25-28H2,(H,42,45)/t37-,40-/m1/s1 |
| InChIKey | NBGPTIVJSFYLSF-PILPWRDFSA-N |
| XLogP | 7.66 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|