C42H41BrN2O4 — CID 23836100
(4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(4-phenylbutyl)-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23836100) has the molecular formula C42H41BrN2O4 and a molecular weight of 717.70 g/mol. Its IUPAC name is (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(4-phenylbutyl)-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(4-phenylbutyl)-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23836100 |
| Molecular Formula | C42H41BrN2O4 |
| Molecular Weight | 717.70 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(4-phenylbutyl)-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)[C@]1(Cc2ccccc2Br)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H41BrN2O4/c43-38-18-8-7-17-36(38)30-42(41(47)44-27-10-9-14-31-12-3-1-4-13-31)39(34-21-19-33(20-22-34)32-15-5-2-6-16-32)49-40(45-42)35-23-25-37(26-24-35)48-29-11-28-46/h1-8,12-13,15-26,39,46H,9-11,14,27-30H2,(H,44,47)/t39-,42-/m1/s1 |
| InChIKey | DBYPVIUDGQOEPB-OLBRMRTOSA-N |
| XLogP | 8.52 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.70 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|