C40H38BrN3O4 — CID 23891851
(4S,5S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(3-methylphenyl)methyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891851) has the molecular formula C40H38BrN3O4 and a molecular weight of 704.67 g/mol. Its IUPAC name is (4S,5S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(3-methylphenyl)methyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(3-methylphenyl)methyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891851 |
| Molecular Formula | C40H38BrN3O4 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 703.20 |
| IUPAC Name | (4S,5S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(3-methylphenyl)methyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | Cc1cccc(CNNC(=O)[C@@]2(Cc3ccccc3Br)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C40H38BrN3O4/c1-28-9-7-10-29(25-28)27-42-44-39(46)40(26-34-13-5-6-14-36(34)41)37(32-17-15-31(16-18-32)30-11-3-2-4-12-30)48-38(43-40)33-19-21-35(22-20-33)47-24-8-23-45/h2-7,9-22,25,37,42,45H,8,23-24,26-27H2,1H3,(H,44,46)/t37-,40-/m0/s1 |
| InChIKey | YTCDLPYBJURMJP-DFUITMLUSA-N |
| XLogP | 7.51 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|