C26H24N4O5 — CID 23777643
(4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxylic acid (PubChem CID 23777643) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxylic acid.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 23777643 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)O)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H24N4O5/c27-30-29-22-10-5-4-9-20(22)17-26(25(32)33)23(18-7-2-1-3-8-18)35-24(28-26)19-11-13-21(14-12-19)34-16-6-15-31/h1-5,7-14,23,31H,6,15-17H2,(H,32,33)/t23-,26-/m1/s1 |
| InChIKey | HZZGKSYTXIDTFT-ZEQKJWHPSA-N |
| XLogP | 4.97 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|