C26H23BrN4O5 — CID 23947968
(4R,5R)-4-[(2-azidophenyl)methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylic acid (PubChem CID 23947968) has the molecular formula C26H23BrN4O5 and a molecular weight of 551.40 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylic acid.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 23947968 |
| Molecular Formula | C26H23BrN4O5 |
| Molecular Weight | 551.40 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)O)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C26H23BrN4O5/c27-21-8-3-2-7-20(21)23-26(25(33)34,16-18-6-1-4-9-22(18)30-31-28)29-24(36-23)17-10-12-19(13-11-17)35-15-5-14-32/h1-4,6-13,23,32H,5,14-16H2,(H,33,34)/t23-,26-/m1/s1 |
| InChIKey | ILCRLOHMHVONBS-ZEQKJWHPSA-N |
| XLogP | 5.74 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|