C31H32BrN5O4 — CID 23947954
[(4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 23947954) has the molecular formula C31H32BrN5O4 and a molecular weight of 618.53 g/mol. Its IUPAC name is [(4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [(4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 23947954 |
| Molecular Formula | C31H32BrN5O4 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | [(4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(Cc1ccccc1Br)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C31H32BrN5O4/c32-26-11-4-2-9-23(26)21-31(30(39)37-17-6-1-7-18-37)28(25-10-3-5-12-27(25)35-36-33)41-29(34-31)22-13-15-24(16-14-22)40-20-8-19-38/h2-5,9-16,28,38H,1,6-8,17-21H2/t28-,31-/m1/s1 |
| InChIKey | VNYOHFXHVPPLAS-GRKNLSHJSA-N |
| XLogP | 6.66 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|