C33H36BrN5O5 — CID 23777395
(4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23777395) has the molecular formula C33H36BrN5O5 and a molecular weight of 662.59 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23777395 |
| Molecular Formula | C33H36BrN5O5 |
| Molecular Weight | 662.59 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(Cc1ccccc1Br)C(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C33H36BrN5O5/c34-27-11-4-2-9-24(27)21-33(31(41)36-22-32(42)17-6-1-7-18-32)29(26-10-3-5-12-28(26)38-39-35)44-30(37-33)23-13-15-25(16-14-23)43-20-8-19-40/h2-5,9-16,29,40,42H,1,6-8,17-22H2,(H,36,41)/t29-,33-/m1/s1 |
| InChIKey | DVHVEZPPHVFHMS-CYTLCNBWSA-N |
| XLogP | 6.46 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|