C28H29N9O4 — CID 23919828
(4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919828) has the molecular formula C28H29N9O4 and a molecular weight of 555.60 g/mol. Its IUPAC name is (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919828 |
| Molecular Formula | C28H29N9O4 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CNNC(=O)[C@@]1(Cc2ccccc2CN=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C28H29N9O4/c1-31-35-27(39)28(17-20-7-2-3-8-21(20)18-32-36-29)25(23-9-4-5-10-24(23)34-37-30)41-26(33-28)19-11-13-22(14-12-19)40-16-6-15-38/h2-5,7-14,25,31,38H,6,15-18H2,1H3,(H,35,39)/t25-,28-/m0/s1 |
| InChIKey | BVPRCGVFWSKGQB-LSYYVWMOSA-N |
| XLogP | 4.95 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|