C30H33N9O4 — CID 23748134
(4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748134) has the molecular formula C30H33N9O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748134 |
| Molecular Formula | C30H33N9O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CC(C)CNNC(=O)[C@@]1(Cc2ccccc2N=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C30H33N9O4/c1-20(2)19-33-37-29(41)30(18-22-8-3-5-10-25(22)35-38-31)27(24-9-4-6-11-26(24)36-39-32)43-28(34-30)21-12-14-23(15-13-21)42-17-7-16-40/h3-6,8-15,20,27,33,40H,7,16-19H2,1-2H3,(H,37,41)/t27-,30-/m0/s1 |
| InChIKey | JNOFNUSIOIOWRC-FIBWVYCGSA-N |
| XLogP | 6.11 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|