C31H36N6O6S — CID 23919200
(4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23919200) has the molecular formula C31H36N6O6S and a molecular weight of 620.73 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23919200 |
| Molecular Formula | C31H36N6O6S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-(2-methylpropyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CC(C)CNNC(=O)[C@@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C31H36N6O6S/c1-22(2)21-33-36-30(39)31(17-20-44(40,41)25-9-4-3-5-10-25)28(26-11-6-7-12-27(26)35-37-32)43-29(34-31)23-13-15-24(16-14-23)42-19-8-18-38/h3-7,9-16,22,28,33,38H,8,17-21H2,1-2H3,(H,36,39)/t28-,31-/m0/s1 |
| InChIKey | KLNZQLGHYNXVMC-IZEXYCQBSA-N |
| XLogP | 4.79 |
| TPSA | 175.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|