C30H32N6O6S — CID 23975843
(4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-N'-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975843) has the molecular formula C30H32N6O6S and a molecular weight of 604.69 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-N'-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-N'-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975843 |
| Molecular Formula | C30H32N6O6S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-N'-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(CCS(=O)(=O)c1ccccc1)C(=O)NNC1CC1 |
| InChI | InChI=1S/C30H32N6O6S/c31-36-34-26-10-5-4-9-25(26)27-30(29(38)35-33-22-13-14-22,17-20-43(39,40)24-7-2-1-3-8-24)32-28(42-27)21-11-15-23(16-12-21)41-19-6-18-37/h1-5,7-12,15-16,22,27,33,37H,6,13-14,17-20H2,(H,35,38)/t27-,30-/m0/s1 |
| InChIKey | OUGUMQOMYVPZQE-FIBWVYCGSA-N |
| XLogP | 4.29 |
| TPSA | 175.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|