C36H36ClN5O6S — CID 23835257
(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835257) has the molecular formula C36H36ClN5O6S and a molecular weight of 702.23 g/mol. Its IUPAC name is (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835257 |
| Molecular Formula | C36H36ClN5O6S |
| Molecular Weight | 702.23 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(CCS(=O)(=O)c1ccccc1)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H36ClN5O6S/c37-29-15-11-26(12-16-29)19-21-39-35(44)36(20-24-49(45,46)31-8-2-1-3-9-31)33(32-10-5-4-7-28(32)25-40-42-38)48-34(41-36)27-13-17-30(18-14-27)47-23-6-22-43/h1-5,7-18,33,43H,6,19-25H2,(H,39,44)/t33-,36-/m1/s1 |
| InChIKey | PLUFLGDHRDHRIJ-YYFXGUOYSA-N |
| XLogP | 6.39 |
| TPSA | 163.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.23 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|