C36H34F3N5O7S — CID 23864323
(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864323) has the molecular formula C36H34F3N5O7S and a molecular weight of 737.76 g/mol. Its IUPAC name is (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864323 |
| Molecular Formula | C36H34F3N5O7S |
| Molecular Weight | 737.76 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(CCS(=O)(=O)c1ccccc1)C(=O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C36H34F3N5O7S/c37-36(38,39)51-29-15-11-25(12-16-29)23-41-34(46)35(19-22-52(47,48)30-8-2-1-3-9-30)32(31-10-5-4-7-27(31)24-42-44-40)50-33(43-35)26-13-17-28(18-14-26)49-21-6-20-45/h1-5,7-18,32,45H,6,19-24H2,(H,41,46)/t32-,35-/m1/s1 |
| InChIKey | PUAOWHWVUDNBPF-FHPVIJFVSA-N |
| XLogP | 6.59 |
| TPSA | 172.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|